|
CAS#: 21524-23-2 Product: 4-Phenyl-6-(Phenylhydrazono)-2,4-Cyclohexadien-1-One No suppilers available for the product. |
| Name | 4-Phenyl-6-(Phenylhydrazono)-2,4-Cyclohexadien-1-One |
|---|---|
| Synonyms | (1,1'-Biphenyl)-4-ol, 3-(phenylazo)-; 3-(Phenylazo)-1,1'-biphenyl-4-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 |
| CAS Registry Number | 21524-23-2 |
| SMILES | O=C\3C(=NNc1ccccc1)\C=C(\c2ccccc2)/C=C/3 |
| InChI | 1S/C18H14N2O/c21-18-12-11-15(14-7-3-1-4-8-14)13-17(18)20-19-16-9-5-2-6-10-16/h1-13,19H |
| InChIKey | XQKSZVPVZSZSRQ-UHFFFAOYSA-N |
| Density | 1.126g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.428°C at 760 mmHg (Cal.) |
| Flash point | 220.163°C (Cal.) |
| Refractive index | 1.613 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Phenyl-6-(Phenylhydrazono)-2,4-Cyclohexadien-1-One |