|
CAS#: 215309-12-9 Product: (3beta)-7-Hydroperoxy-17-Oxoandrost-5-En-3-Yl Acetate No suppilers available for the product. |
| Name | (3beta)-7-Hydroperoxy-17-Oxoandrost-5-En-3-Yl Acetate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.46 |
| CAS Registry Number | 215309-12-9 |
| SMILES | CC(=O)O[C@H]1CC[C@@]2([C@H]3CC[C@]4([C@H]([C@@H]3[C@@H](C=C2C1)OO)CCC4=O)C)C |
| InChI | 1S/C21H30O5/c1-12(22)25-14-6-8-20(2)13(10-14)11-17(26-24)19-15-4-5-18(23)21(15,3)9-7-16(19)20/h11,14-17,19,24H,4-10H2,1-3H3/t14-,15-,16-,17+,19-,20-,21-/m0/s1 |
| InChIKey | HDOAVFDXGPMIQG-MXRBDKCISA-N |
| Density | 1.212g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.187°C at 760 mmHg (Cal.) |
| Flash point | 170.949°C (Cal.) |
| Refractive index | 1.555 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3beta)-7-Hydroperoxy-17-Oxoandrost-5-En-3-Yl Acetate |