|
CAS#: 21532-74-1 Product: 1,10-Phenanthroline Perchlorate No suppilers available for the product. |
| Name | 1,10-Phenanthroline Perchlorate |
|---|---|
| Synonyms | 1,10-Phenanthroline Perchlorate; 1,10-Phenanthroline, Monoperchlorate; 1,10-Phenanthroline, Perchloric Acid Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9ClN2O4 |
| Molecular Weight | 280.67 |
| CAS Registry Number | 21532-74-1 |
| EINECS | 244-425-1 |
| SMILES | O=[Cl](O)(=O)=O.C2=CC1=C(N=CC=C1)C3=C2C=CC=N3 |
| InChI | 1S/C12H8N2.ClHO4/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;2-1(3,4)5/h1-8H;(H,2,3,4,5) |
| InChIKey | YWCGYBWTNQEUGU-UHFFFAOYSA-N |
| Boiling point | 365.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 164.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,10-Phenanthroline Perchlorate |