|
CAS#: 215436-24-1 Product: 2,2-Dimethyl-5-({[(4-Methylphenyl)Sulfonyl]Oxy}Imino)-1,3-Dioxane-4,6-Dione No suppilers available for the product. |
| Name | 2,2-Dimethyl-5-({[(4-Methylphenyl)Sulfonyl]Oxy}Imino)-1,3-Dioxane-4,6-Dione |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H13NO7S |
| Molecular Weight | 327.31 |
| CAS Registry Number | 215436-24-1 |
| SMILES | O=C2OC(OC(=O)\C2=N\OS(=O)(=O)c1ccc(cc1)C)(C)C |
| InChI | 1S/C13H13NO7S/c1-8-4-6-9(7-5-8)22(17,18)21-14-10-11(15)19-13(2,3)20-12(10)16/h4-7H,1-3H3 |
| InChIKey | IFNDHYIZZLDILT-UHFFFAOYSA-N |
| Density | 1.444g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.407°C at 760 mmHg (Cal.) |
| Flash point | 206.241°C (Cal.) |
| Refractive index | 1.585 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dimethyl-5-({[(4-Methylphenyl)Sulfonyl]Oxy}Imino)-1,3-Dioxane-4,6-Dione |