Online Database of Chemicals from Around the World
|
CAS#: 21567-21-5 Product: 4-Hydroxynonachlorodiphenyl Ether No suppilers available for the product. |
| Name | 4-Hydroxynonachlorodiphenyl Ether |
|---|---|
| Synonyms | 2,3,5,6-Tetrachloro-4-(Pentachlorophenoxy)Phenol; 4-06-00-05776 (Beilstein Handbook Reference); 4-Hydroxy-Nonachlorodiphenyl Ether |
| Molecular Structure |  |
| Molecular Formula | C12HCl9O2 |
| Molecular Weight | 496.22 |
| CAS Registry Number | 21567-21-5 |
| SMILES | C1(=C(C(=C(C(=C1Cl)Cl)OC2=C(C(=C(C(=C2Cl)Cl)Cl)Cl)Cl)Cl)Cl)O |
| InChI | 1S/C12HCl9O2/c13-1-2(14)6(18)11(7(19)3(1)15)23-12-8(20)4(16)10(22)5(17)9(12)21/h22H |
| InChIKey | ZVVFIXFTAITHQK-UHFFFAOYSA-N |
| Density | 1.865g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.617°C at 760 mmHg (Cal.) |
| Flash point | 222.697°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Hydroxynonachlorodiphenyl Ether |