|
CAS#: 21572-26-9 Product: Phenyl(Trivinyl)Stannane No suppilers available for the product. |
| Name | Phenyl(Trivinyl)Stannane |
|---|---|
| Synonyms | Phenyl(trivinyl)stannane # |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14Sn |
| Molecular Weight | 276.95 |
| CAS Registry Number | 21572-26-9 |
| SMILES | C=C\[Sn](c1ccccc1)(\C=C)\C=C |
| InChI | 1S/C6H5.3C2H3.Sn/c1-2-4-6-5-3-1;3*1-2;/h1-5H;3*1H,2H2; |
| InChIKey | QFFPDACBFGDFBS-UHFFFAOYSA-N |
| Boiling point | 254.218°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 109.395°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl(Trivinyl)Stannane |