|
CAS#: 21578-94-9 Product: Peroxyterephthalic acid, ditert-butyl ester No suppilers available for the product. |
| Name | Peroxyterephthalic acid, ditert-butyl ester |
|---|---|
| Synonyms | Benzene-1,4-Dicarboperoxoic Acid O1,O4-Ditert-Butyl Ester; Bis(1,1-Dimethylethyl) Dioxyterephthalate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 |
| CAS Registry Number | 21578-94-9 |
| EINECS | 244-451-3 |
| SMILES | C1=C(C(OOC(C)(C)C)=O)C=CC(=C1)C(OOC(C)(C)C)=O |
| InChI | 1S/C16H22O6/c1-15(2,3)21-19-13(17)11-7-9-12(10-8-11)14(18)20-22-16(4,5)6/h7-10H,1-6H3 |
| InChIKey | MEBDAPKZBGYVCA-UHFFFAOYSA-N |
| Density | 1.12g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.836°C at 760 mmHg (Cal.) |
| Flash point | 194.094°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Peroxyterephthalic acid, ditert-butyl ester |