|
CAS#: 21583-77-7 Product: 2-(4-Aminophenyl)-4,5,6-Trichloro-3(2H)-Pyridazinone No suppilers available for the product. |
| Name | 2-(4-Aminophenyl)-4,5,6-Trichloro-3(2H)-Pyridazinone |
|---|---|
| Synonyms | 2-(4-aminophenyl)-4,5,6-trichloro-3(2H)-pyridazinone; Aptcpz |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6Cl3N3O |
| Molecular Weight | 290.53 |
| CAS Registry Number | 21583-77-7 |
| SMILES | Cl/C2=N/N(c1ccc(N)cc1)C(=O)C(/Cl)=C2/Cl |
| InChI | 1S/C10H6Cl3N3O/c11-7-8(12)10(17)16(15-9(7)13)6-3-1-5(14)2-4-6/h1-4H,14H2 |
| InChIKey | DACHTFAAGHUYRF-UHFFFAOYSA-N |
| Density | 1.669g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.607°C at 760 mmHg (Cal.) |
| Flash point | 203.338°C (Cal.) |
| Refractive index | 1.697 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Aminophenyl)-4,5,6-Trichloro-3(2H)-Pyridazinone |