|
CAS#: 215929-34-3 Product: 2-(2-Methoxy-5-Methylphenyl)-2-Phenylpropanoic Acid No suppilers available for the product. |
| Name | 2-(2-Methoxy-5-Methylphenyl)-2-Phenylpropanoic Acid |
|---|---|
| Synonyms | 2-(2-Methoxy-5-methylphenyl)-2-phenylpropanoic acid; 2-(2-Methoxy-5-methylphenyl)-2-phenylpropansäure |
| Molecular Structure | ![]() |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.32 |
| CAS Registry Number | 215929-34-3 |
| SMILES | Cc1ccc(c(c1)C(C)(c2ccccc2)C(=O)O)OC |
| InChI | 1S/C17H18O3/c1-12-9-10-15(20-3)14(11-12)17(2,16(18)19)13-7-5-4-6-8-13/h4-11H,1-3H3,(H,18,19) |
| InChIKey | ZGUFEIQLWVFMHJ-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.3±33.0°C at 760 mmHg (Cal.) |
| Flash point | 149.2±18.9°C (Cal.) |
| Refractive index | 1.566 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Methoxy-5-Methylphenyl)-2-Phenylpropanoic Acid |