|
CAS#: 21623-11-0 Product: Isozeatin No suppilers available for the product. |
| Name | Isozeatin |
|---|---|
| Synonyms | 2-Buten-1-Ol, 3-Methyl-4-(1H-Purin-6-Ylamino)-, (E)-; E-Isozeatin; Isozeatin |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 |
| CAS Registry Number | 21623-11-0 |
| SMILES | C1=NC2=C([NH]1)C(=NC=N2)NC\C(C)=C\CO |
| InChI | 1S/C10H13N5O/c1-7(2-3-16)4-11-9-8-10(13-5-12-8)15-6-14-9/h2,5-6,16H,3-4H2,1H3,(H2,11,12,13,14,15)/b7-2+ |
| InChIKey | GPKGHQSZBVRAPF-FARCUNLSSA-N |
| Density | 1.388g/cm3 (Cal.) |
|---|---|
| Boiling point | 583.885°C at 760 mmHg (Cal.) |
| Flash point | 306.923°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isozeatin |