Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | (3-Amino-4-Hydroxyphenyl)Arsonic Acid |
|---|---|
| Synonyms | (3-Amino-4-Hydroxy-Phenyl)Arsonic Acid; 3-Amino-4-Hydroxybenzenearsonic Acid; 3-Amino-4-Hydroxyphenylarsonic Acid |
| Molecular Structure |  |
| Molecular Formula | C6H8AsNO4 |
| Molecular Weight | 233.06 |
| CAS Registry Number | 2163-77-1 |
| EINECS | 218-494-3 |
| SMILES | C1=C(C(=CC=C1[As](=O)(O)O)O)N |
| InChI | 1S/C6H8AsNO4/c8-5-3-4(7(10,11)12)1-2-6(5)9/h1-3,9H,8H2,(H2,10,11,12) |
| InChIKey | UAKCHCFOPKOOLI-UHFFFAOYSA-N |
| Boiling point | 586.017°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 308.212°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3-Amino-4-Hydroxyphenyl)Arsonic Acid |