|
CAS#: 21650-83-9 Product: 3beta-Hydroxy-5alpha-Pregna-9(11),16-Dien-20-One 3-Acetate No suppilers available for the product. |
| Name | 3beta-Hydroxy-5alpha-Pregna-9(11),16-Dien-20-One 3-Acetate |
|---|---|
| Synonyms | Acetic Acid (17-Acetyl-10,13-Dimethyl-2,3,4,5,6,7,8,12,14,15-Decahydro-1H-Cyclopenta[A]Phenanthren-3-Yl) Ester; (17-Ethanoyl-10,13-Dimethyl-2,3,4,5,6,7,8,12,14,15-Decahydro-1H-Cyclopenta[A]Phenanthren-3-Yl) Ethanoate; 3Beta-Hydroxy-5Alpha-Pregna-9(11),16-Dien-20-One 3-Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.50 |
| CAS Registry Number | 21650-83-9 |
| EINECS | 244-497-4 |
| SMILES | CC14C(C3C(=CC1)C2(C(CC(OC(C)=O)CC2)CC3)C)CC=C4C(C)=O |
| InChI | 1S/C23H32O3/c1-14(24)19-7-8-20-18-6-5-16-13-17(26-15(2)25)9-11-22(16,3)21(18)10-12-23(19,20)4/h7,10,16-18,20H,5-6,8-9,11-13H2,1-4H3 |
| InChIKey | GBSGMSKNTLPLQF-UHFFFAOYSA-N |
| Density | 1.112g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.444°C at 760 mmHg (Cal.) |
| Flash point | 201.952°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3beta-Hydroxy-5alpha-Pregna-9(11),16-Dien-20-One 3-Acetate |