|
CAS#: 21654-64-8 Product: 4-Methyl-2,2,3-triphenyl-1,3,2-oxazasilolidin-5-one No suppilers available for the product. |
| Name | 4-Methyl-2,2,3-triphenyl-1,3,2-oxazasilolidin-5-one |
|---|---|
| Synonyms | 4-Methyl-2,2,3-triphenyl-1,3,2-oxazasilolidin-5-one # |
| Molecular Structure | ![]() |
| Molecular Formula | C21H19NO2Si |
| Molecular Weight | 345.47 |
| CAS Registry Number | 21654-64-8 |
| SMILES | O=C3O[Si](c1ccccc1)(N(c2ccccc2)C3C)c4ccccc4 |
| InChI | 1S/C21H19NO2Si/c1-17-21(23)24-25(19-13-7-3-8-14-19,20-15-9-4-10-16-20)22(17)18-11-5-2-6-12-18/h2-17H,1H3 |
| InChIKey | IZDAABBSHXMDQH-UHFFFAOYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 425.85°C at 760 mmHg (Cal.) |
| Flash point | 211.347°C (Cal.) |
| Refractive index | 1.636 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-2,2,3-triphenyl-1,3,2-oxazasilolidin-5-one |