|
CAS#: 21667-10-7 Product: Inositol 4-Phosphate No suppilers available for the product. |
| Name | Inositol 4-Phosphate |
|---|---|
| Synonyms | Dl-Myo-Inositol, 4-(Dihydrogen Phosphate); Inositol 4-Monophosphate; Myoinositol 4-Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13O9P |
| Molecular Weight | 260.14 |
| CAS Registry Number | 21667-10-7 |
| SMILES | [C@H]1(O)C(O[P](O)(O)=O)[C@@H](O)[C@H](O)C(O)[C@H]1O |
| InChI | 1S/C6H13O9P/c7-1-2(8)4(10)6(5(11)3(1)9)15-16(12,13)14/h1-11H,(H2,12,13,14)/t1?,2-,3-,4-,5+,6?/m1/s1 |
| InChIKey | INAPMGSXUVUWAF-WWHKVMGRSA-N |
| Density | 2.027g/cm3 (Cal.) |
|---|---|
| Boiling point | 517.442°C at 760 mmHg (Cal.) |
| Flash point | 266.74°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Inositol 4-Phosphate |