| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-(4-Nitrophenyl)-2-Methyl-4-Nitroimidazole |
|---|---|
| Synonyms | Altimol; 1H-Imidazole, 2-Methyl-4-Nitro-1-(4-Nitrophenyl)- (9Ci); 5-23-05-00078 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8N4O4 |
| Molecular Weight | 248.20 |
| CAS Registry Number | 21721-92-6 |
| EINECS | 244-542-8 |
| SMILES | C1=C([N+](=O)[O-])N=C([N]1C2=CC=C([N+](=O)[O-])C=C2)C |
| InChI | 1S/C10H8N4O4/c1-7-11-10(14(17)18)6-12(7)8-2-4-9(5-3-8)13(15)16/h2-6H,1H3 |
| InChIKey | NMTBSNPBIGRZBL-UHFFFAOYSA-N |
| Density | 1.532g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.894°C at 760 mmHg (Cal.) |
| Flash point | 247.055°C (Cal.) |
| (1) | P. Wagner and M. Kubicki. 2-Methyl-4-nitro-1-(4-nitrophenyl)-1H-imidazole, Acta Cryst. (2007). E63, o3083 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(4-Nitrophenyl)-2-Methyl-4-Nitroimidazole |