|
CAS#: 21762-25-4 Product: 2-(3-Amino-2,4,6-Triiodophenyl)Butyric Acid No suppilers available for the product. |
| Name | 2-(3-Amino-2,4,6-Triiodophenyl)Butyric Acid |
|---|---|
| Synonyms | 2-(3-Amino-2,4,6-Triiodo-Phenyl)Butanoic Acid; 2-(3-Amino-2,4,6-Triiodo-Phenyl)Butyric Acid; 2-(3-Amino-2,4,6-Triiodophenyl)Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10I3NO2 |
| Molecular Weight | 556.91 |
| CAS Registry Number | 21762-25-4 |
| SMILES | C1=C(C(=C(C(=C1I)C(C(O)=O)CC)I)N)I |
| InChI | 1S/C10H10I3NO2/c1-2-4(10(15)16)7-5(11)3-6(12)9(14)8(7)13/h3-4H,2,14H2,1H3,(H,15,16) |
| InChIKey | SHDHSGPFZOKKBX-UHFFFAOYSA-N |
| Density | 2.541g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.966°C at 760 mmHg (Cal.) |
| Flash point | 271.29°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Amino-2,4,6-Triiodophenyl)Butyric Acid |