|
CAS#: 21784-30-5 Product: Phendimetrazine No suppilers available for the product. |
| Name | Phendimetrazine |
|---|---|
| Synonyms | 3,4-Dimethyl-2-Phenyl-Morpholine Hydrochloride; (+-)-3,4-Dimethyl-2-Phenylmorpholine Hydrochloride; Morpholine, 3,4-Dimethyl-2-Phenyl-, Hydrochloride, (+-)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.73 |
| CAS Registry Number | 21784-30-5 |
| SMILES | [H+].C2=C(C1OCCN(C1C)C)C=CC=C2.[Cl-] |
| InChI | 1S/C12H17NO.ClH/c1-10-12(14-9-8-13(10)2)11-6-4-3-5-7-11;/h3-7,10,12H,8-9H2,1-2H3;1H |
| InChIKey | OOQWOQSMHKWCEB-UHFFFAOYSA-N |
| Boiling point | 275.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 80.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phendimetrazine |