|
CAS#: 21802-48-2 Product: 1-Ethyl-Adenine No suppilers available for the product. |
| Name | 1-Ethyl-Adenine |
|---|---|
| Synonyms | 1-Ethyl-6-Purinamine; (1-Ethylpurin-6-Yl)Amine; Adenine, 1-Ethyl- (7Ci,8Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 |
| CAS Registry Number | 21802-48-2 |
| SMILES | C([N]2C(=C1N=CN=C1N=C2)N)C |
| InChI | 1S/C7H9N5/c1-2-12-4-11-7-5(6(12)8)9-3-10-7/h3-4H,2,8H2,1H3 |
| InChIKey | NLGIGNOZJPHHML-UHFFFAOYSA-N |
| Density | 1.497g/cm3 (Cal.) |
|---|---|
| Boiling point | 256.028°C at 760 mmHg (Cal.) |
| Flash point | 108.642°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Ethyl-Adenine |