|
CAS#: 21856-97-3 Product: Phenyl{Bis[4-(Trifluoromethyl)Phenyl]}Methanol No suppilers available for the product. |
| Name | Phenyl{Bis[4-(Trifluoromethyl)Phenyl]}Methanol |
|---|---|
| Synonyms | p,p'-bis(Trifluoromethyl)triphenylcarbinol; Phenyl(bis[4-(trifluoromethyl)phenyl])methanol # |
| Molecular Structure | ![]() |
| Molecular Formula | C21H14F6O |
| Molecular Weight | 396.33 |
| CAS Registry Number | 21856-97-3 |
| SMILES | FC(F)(F)c1ccc(cc1)C(O)(c2ccccc2)c3ccc(cc3)C(F)(F)F |
| InChI | 1S/C21H14F6O/c22-20(23,24)17-10-6-15(7-11-17)19(28,14-4-2-1-3-5-14)16-8-12-18(13-9-16)21(25,26)27/h1-13,28H |
| InChIKey | VYIVXWSAQLKHBR-UHFFFAOYSA-N |
| Density | 1.333g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.451°C at 760 mmHg (Cal.) |
| Flash point | 214.734°C (Cal.) |
| Refractive index | 1.524 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl{Bis[4-(Trifluoromethyl)Phenyl]}Methanol |