|
CAS#: 21898-91-9 Product: Tricyclo[4.3.1.13,8]Undecane-3-Carboxylic Acid No suppilers available for the product. |
| Name | Tricyclo[4.3.1.13,8]Undecane-3-Carboxylic Acid |
|---|---|
| Synonyms | 3-Homoadamantanecarboxylic acid; Tricyclo[4.3.1.1(3,8)]undecane-3-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 |
| CAS Registry Number | 21898-91-9 |
| SMILES | O=C(O)C32CCC1CC(CC(C1)C2)C3 |
| InChI | 1S/C12H18O2/c13-11(14)12-2-1-8-3-9(6-12)5-10(4-8)7-12/h8-10H,1-7H2,(H,13,14) |
| InChIKey | ZWJPDTCMULYABF-UHFFFAOYSA-N |
| Density | 1.183g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.399°C at 760 mmHg (Cal.) |
| Flash point | 150.734°C (Cal.) |
| Refractive index | 1.557 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tricyclo[4.3.1.13,8]Undecane-3-Carboxylic Acid |