| Name | 3,3',5,5'-Tetrabromo[1,1'-Biphenyl]-2,2'-Diol |
|---|---|
| Synonyms | 2,4-Dichloro-6-(3,5-Dichloro-2-Hydroxy-Phenyl)Phenol; 3,3',5,5'-Tetrabromo(1,1'-Biphenyl)-2,2'-Diol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6Cl4O2 |
| Molecular Weight | 323.99 |
| CAS Registry Number | 21951-40-6 |
| EINECS | 244-679-3 |
| SMILES | C2=C(C1=C(O)C(=CC(=C1)Cl)Cl)C(=C(Cl)C=C2Cl)O |
| InChI | 1S/C12H6Cl4O2/c13-5-1-7(11(17)9(15)3-5)8-2-6(14)4-10(16)12(8)18/h1-4,17-18H |
| InChIKey | NXBKBCZEXWIAML-UHFFFAOYSA-N |
| Density | 1.625g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.159°C at 760 mmHg (Cal.) |
| Flash point | 199.438°C (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3,3',5,5'-Tetrabromo[1,1'-Biphenyl]-2,2'-Diol |