|
CAS#: 2198-93-8 Product: (4-beta)-12,13-Epoxytrichothec-9-En-4-Ol No suppilers available for the product. |
| Name | (4-beta)-12,13-Epoxytrichothec-9-En-4-Ol |
|---|---|
| Synonyms | 12,13-Epoxytrichothec-9-En-4-Beta-Ol; Brn 1287601; Roridin C |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 |
| CAS Registry Number | 2198-93-8 |
| SMILES | [C@H]13O[C@H]4[C@@](C(C12OC2)([C@H](O)C3)C)(CCC(=C4)C)C |
| InChI | 1S/C15H22O3/c1-9-4-5-13(2)11(6-9)18-12-7-10(16)14(13,3)15(12)8-17-15/h6,10-12,16H,4-5,7-8H2,1-3H3/t10-,11-,12-,13+,14?,15?/m1/s1 |
| InChIKey | XSUVNTHNQMGPIL-YNBGEIFUSA-N |
| Density | 1.209g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.238°C at 760 mmHg (Cal.) |
| Flash point | 179.528°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-beta)-12,13-Epoxytrichothec-9-En-4-Ol |