|
CAS#: 220-97-3 Product: 11H-Indeno[2,1-a]Phenanthrene No suppilers available for the product. |
| Name | 11H-Indeno[2,1-a]Phenanthrene |
|---|---|
| Synonyms | 11H-Indeno(2,1-A)Phenanthrene |
| Molecular Structure | ![]() |
| Molecular Formula | C21H14 |
| Molecular Weight | 266.34 |
| CAS Registry Number | 220-97-3 |
| EINECS | 205-926-0 |
| SMILES | C1=C4C(=C2C(=C1)C3=C(C=C2)C=CC=C3)CC5=CC=CC=C45 |
| InChI | 1S/C21H14/c1-3-7-16-14(5-1)9-10-20-18(16)11-12-19-17-8-4-2-6-15(17)13-21(19)20/h1-12H,13H2 |
| InChIKey | JPAMAQWNSMPRLT-UHFFFAOYSA-N |
| Density | 1.23g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.653°C at 760 mmHg (Cal.) |
| Flash point | 242.874°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11H-Indeno[2,1-a]Phenanthrene |