|
CAS#: 220120-59-2 Product: Ethyl 6-Fluoro-3,4-Dihydro-2H-1,4-Benzoxazine-2-Carboxylate No suppilers available for the product. |
| Name | Ethyl 6-Fluoro-3,4-Dihydro-2H-1,4-Benzoxazine-2-Carboxylate |
|---|---|
| Synonyms | 2H-1,4-BE |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12FNO3 |
| Molecular Weight | 225.22 |
| CAS Registry Number | 220120-59-2 |
| SMILES | Fc2ccc1OC(C(=O)OCC)CNc1c2 |
| InChI | 1S/C11H12FNO3/c1-2-15-11(14)10-6-13-8-5-7(12)3-4-9(8)16-10/h3-5,10,13H,2,6H2,1H3 |
| InChIKey | NHOMLOLSDHZKLL-UHFFFAOYSA-N |
| Density | 1.24g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.025°C at 760 mmHg (Cal.) |
| Flash point | 146.742°C (Cal.) |
| Refractive index | 1.51 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 6-Fluoro-3,4-Dihydro-2H-1,4-Benzoxazine-2-Carboxylate |