|
CAS#: 2202-08-6 Product: 4,5-alpha-Epoxy-3-Methoxy-17-Methyl-Morphinan-8-beta-Ol Acetate No suppilers available for the product. |
| Name | 4,5-alpha-Epoxy-3-Methoxy-17-Methyl-Morphinan-8-beta-Ol Acetate |
|---|---|
| Synonyms | Pseudocodeine, Acetyldihydro-; Acetyldihydropseudocodeine |
| Molecular Structure | ![]() |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 |
| CAS Registry Number | 2202-08-6 |
| SMILES | [C@@H]15CC4=C3[C@@]2([C@H]1[C@H](CC[C@@H]2OC3=C(C=C4)OC)OC(C)=O)CCN5C |
| InChI | 1S/C20H25NO4/c1-11(22)24-14-6-7-16-20-8-9-21(2)13(18(14)20)10-12-4-5-15(23-3)19(25-16)17(12)20/h4-5,13-14,16,18H,6-10H2,1-3H3/t13-,14+,16+,18-,20-/m1/s1 |
| InChIKey | HPGMEYZSERNHAC-PJMNMZBVSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.416°C at 760 mmHg (Cal.) |
| Flash point | 235.275°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-alpha-Epoxy-3-Methoxy-17-Methyl-Morphinan-8-beta-Ol Acetate |