|
CAS#: 22020-29-7 Product: Methyl (2E)-3-{3,4-Bis[(Trimethylsilyl)Oxy]Phenyl}Acrylate No suppilers available for the product. |
| Name | Methyl (2E)-3-{3,4-Bis[(Trimethylsilyl)Oxy]Phenyl}Acrylate |
|---|---|
| Synonyms | Methyl (2 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H26O4Si2 |
| Molecular Weight | 338.55 |
| CAS Registry Number | 22020-29-7 |
| SMILES | O=C(OC)\C=C\c1cc(O[Si](C)(C)C)c(O[Si](C)(C)C)cc1 |
| InChI | 1S/C16H26O4Si2/c1-18-16(17)11-9-13-8-10-14(19-21(2,3)4)15(12-13)20-22(5,6)7/h8-12H,1-7H3/b11-9+ |
| InChIKey | FZDKVAWFXXDDPA-PKNBQFBNSA-N |
| Density | 1.008g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.37°C at 760 mmHg (Cal.) |
| Flash point | 139.216°C (Cal.) |
| Refractive index | 1.495 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (2E)-3-{3,4-Bis[(Trimethylsilyl)Oxy]Phenyl}Acrylate |