Online Database of Chemicals from Around the World
|
CAS#: 22049-75-8 Product: 1-(1-L-Alanyl-L-Prolyl)-L-Proline No suppilers available for the product. |
| Name | 1-(1-L-Alanyl-L-Prolyl)-L-Proline |
|---|---|
| Synonyms | 1-[[1-(2-Amino-1-Oxopropyl)-2-Pyrrolidinyl]-Oxomethyl]-2-Pyrrolidinecarboxylic Acid; 1-(1-Alanylpyrrolidine-2-Carbonyl)Proline; 1-[1-(2-Aminopropanoyl)Pyrrolidin-2-Yl]Carbonylpyrrolidine-2-Carboxylic Acid |
| Molecular Structure |  |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 |
| CAS Registry Number | 22049-75-8 |
| EINECS | 244-755-6 |
| SMILES | CC(N)C(N2C(C(N1C(C(=O)O)CCC1)=O)CCC2)=O |
| InChI | 1S/C13H21N3O4/c1-8(14)11(17)15-6-2-4-9(15)12(18)16-7-3-5-10(16)13(19)20/h8-10H,2-7,14H2,1H3,(H,19,20) |
| InChIKey | OLVCTPPSXNRGKV-UHFFFAOYSA-N |
| Density | 1.343g/cm3 (Cal.) |
|---|---|
| Boiling point | 564.653°C at 760 mmHg (Cal.) |
| Flash point | 295.291°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1-L-Alanyl-L-Prolyl)-L-Proline |