|
CAS#: 22059-16-1 Product: Homoestradiol No suppilers available for the product. |
| Name | Homoestradiol |
|---|---|
| Synonyms | D-Homoestra-1,3,5(10)-Triene-3,17-Diol; D-Homoestra-1,3,5(10)-Triene-3,17A-Diol, (17Aalpha)-; Homo-Estradiol |
| Molecular Structure | ![]() |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 |
| CAS Registry Number | 22059-16-1 |
| SMILES | [C@H]4(O)[C@@]1([C@H]([C@H]3[C@H](CC1)C2=CC=C(C=C2CC3)O)CCC4)C |
| InChI | 1S/C19H26O2/c1-19-10-9-15-14-8-6-13(20)11-12(14)5-7-16(15)17(19)3-2-4-18(19)21/h6,8,11,15-18,20-21H,2-5,7,9-10H2,1H3/t15-,16-,17+,18-,19+/m1/s1 |
| InChIKey | JJKPSTJJBVJKKQ-FQBWVUSXSA-N |
| Density | 1.144g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.863°C at 760 mmHg (Cal.) |
| Flash point | 213.365°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Homoestradiol |