|
CAS#: 22083-76-7 Product: Nicotine Monomethiodide No suppilers available for the product. |
| Name | Nicotine Monomethiodide |
|---|---|
| Synonyms | Iodomethane; 3-[(2S)-1-Methyl-2-Pyrrolidinyl]Pyridine; Iodomethane; Nicotine; Nicotine Monomethiodide |
| Molecular Structure | ![]() |
| Molecular Formula | C11H17IN2 |
| Molecular Weight | 304.17 |
| CAS Registry Number | 22083-76-7 |
| SMILES | [C@@H]1(N(CCC1)C)C2=CC=CN=C2.CI |
| InChI | 1S/C10H14N2.CH3I/c1-12-7-3-5-10(12)9-4-2-6-11-8-9;1-2/h2,4,6,8,10H,3,5,7H2,1H3;1H3/t10-;/m0./s1 |
| InChIKey | YLLWAVOIHHJKNC-PPHPATTJSA-N |
| Boiling point | 244.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 101.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nicotine Monomethiodide |