Online Database of Chemicals from Around the World
|
CAS#: 22106-14-5 Product: 7-Chloro-2,5-Dimethyl-1,2,3,4-Tetrahydropyrimido[1,6-a]Indole No suppilers available for the product. |
| Name | 7-Chloro-2,5-Dimethyl-1,2,3,4-Tetrahydropyrimido[1,6-a]Indole |
|---|---|
| Synonyms | 7-Chloro-2,5-Dimethyl-1,2,3,4-Tetrahydropyrimino(3,4-A)Indole; Brn 0653064; Pyrimido(3,4-A)Indole, 1,2,3,4-Tetrahydro-7-Chloro-2,5-Dimethyl- |
| Molecular Structure | ![CAS#: 22106-14-5, 7-Chloro-2,5-Dimethyl-1,2,3,4-Tetrahydropyrimido[1,6-a]Indole](/moreStructures/22106-14-5.gif) |
| Molecular Formula | C13H15ClN2 |
| Molecular Weight | 234.73 |
| CAS Registry Number | 22106-14-5 |
| SMILES | C1=C(C=CC2=C1C(=C3[N]2CN(CC3)C)C)Cl |
| InChI | 1S/C13H15ClN2/c1-9-11-7-10(14)3-4-13(11)16-8-15(2)6-5-12(9)16/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | IRZSWPJYGDXTIV-UHFFFAOYSA-N |
| Density | 1.265g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.308°C at 760 mmHg (Cal.) |
| Flash point | 189.247°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Chloro-2,5-Dimethyl-1,2,3,4-Tetrahydropyrimido[1,6-a]Indole |