Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | [(1R,2R)-2-Acetoxycyclopentyl]Methyl Acetate |
|---|---|
| Synonyms | ((1R,2R)-2-acetoxycyclopentyl)methyl acetate |
| Molecular Structure | ![CAS#: 221258-61-3, [(1R,2R)-2-Acetoxycyclopentyl]Methyl Acetate](/moreStructures/221258-61-3.gif) |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 |
| CAS Registry Number | 221258-61-3 |
| SMILES | O=C(O[C@@H]1CCC[C@@H]1COC(=O)C)C |
| InChI | 1S/C10H16O4/c1-7(11)13-6-9-4-3-5-10(9)14-8(2)12/h9-10H,3-6H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | NXCVHSHZSDNNEB-NXEZZACHSA-N |
| Density | 1.092g/cm3 (Cal.) |
|---|---|
| Boiling point | 246.727°C at 760 mmHg (Cal.) |
| Flash point | 113.61°C (Cal.) |
| Refractive index | 1.457 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(1R,2R)-2-Acetoxycyclopentyl]Methyl Acetate |