|
CAS#: 22146-03-8 Product: 7beta,8-Epoxy-3beta,11alpha,14-Trihydroxy-12-Oxo-5beta-Card-20(22)-Enolide No suppilers available for the product. |
| Name | 7beta,8-Epoxy-3beta,11alpha,14-Trihydroxy-12-Oxo-5beta-Card-20(22)-Enolide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.48 |
| CAS Registry Number | 22146-03-8 |
| SMILES | O=C1/C=C(\CO1)[C@H]2CC[C@@]5(O)[C@]2(C)C(=O)[C@@H](O)[C@@H]4[C@@]6(C)CC[C@H](O)C[C@H]6C[C@@H]3O[C@@]345 |
| InChI | 1S/C23H30O7/c1-20-5-3-13(24)8-12(20)9-15-23(30-15)18(20)17(26)19(27)21(2)14(4-6-22(21,23)28)11-7-16(25)29-10-11/h7,12-15,17-18,24,26,28H,3-6,8-10H2,1-2H3/t12-,13-,14+,15-,17-,18+,20-,21-,22+,23-/m0/s1 |
| InChIKey | ACXJWHRFZUSCNC-QBOSKRDWSA-N |
| Density | 1.444g/cm3 (Cal.) |
|---|---|
| Boiling point | 681.806°C at 760 mmHg (Cal.) |
| Flash point | 239.309°C (Cal.) |
| Refractive index | 1.638 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7beta,8-Epoxy-3beta,11alpha,14-Trihydroxy-12-Oxo-5beta-Card-20(22)-Enolide |