|
CAS#: 2215-16-9 Product: Di(Phenyl)Arsanyloxy-Di(Phenyl)Arsane No suppilers available for the product. |
| Name | Di(Phenyl)Arsanyloxy-Di(Phenyl)Arsane |
|---|---|
| Synonyms | Arsine, Oxybis[Diphenyl-; Bis(Diphenylarsinyl) Oxide; Nsc12675 |
| Molecular Structure | ![]() |
| Molecular Formula | C24H20As2O |
| Molecular Weight | 474.26 |
| CAS Registry Number | 2215-16-9 |
| SMILES | C1=CC=CC=C1[As](C2=CC=CC=C2)O[As](C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | 1S/C24H20As2O/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22)27-26(23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H |
| InChIKey | ILPSKCGUNGMBPP-UHFFFAOYSA-N |
| Boiling point | 495.085°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 169.997°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Di(Phenyl)Arsanyloxy-Di(Phenyl)Arsane |