|
CAS#: 2217-59-6 Product: 3,3-Bis(Ethylsulfonyl)Pentane No suppilers available for the product. |
| Name | 3,3-Bis(Ethylsulfonyl)Pentane |
|---|---|
| Synonyms | 1-(1-Ethyl-1-Ethylsulfonyl-Propyl)Sulfonylethane; Pentane, 3,3-Bis(Ethylsulfonyl)-; Tetronal |
| Molecular Structure | ![]() |
| Molecular Formula | C9H20O4S2 |
| Molecular Weight | 256.37 |
| CAS Registry Number | 2217-59-6 |
| SMILES | C([S](C([S](=O)(=O)CC)(CC)CC)(=O)=O)C |
| InChI | 1S/C9H20O4S2/c1-5-9(6-2,14(10,11)7-3)15(12,13)8-4/h5-8H2,1-4H3 |
| InChIKey | VTZYVPLHCQBWSP-UHFFFAOYSA-N |
| Density | 1.17g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.435°C at 760 mmHg (Cal.) |
| Flash point | 284.73°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Bis(Ethylsulfonyl)Pentane |