|
CAS#: 222-51-5 Product: Dibenzo(c,m)Pentaphene No suppilers available for the product. |
| Name | Dibenzo(c,m)Pentaphene |
|---|---|
| Synonyms | Dibenzo[C,M]Pentaphene |
| Molecular Structure | ![]() |
| Molecular Formula | C30H18 |
| Molecular Weight | 378.47 |
| CAS Registry Number | 222-51-5 |
| SMILES | C1=C6C(=CC2=C1C=CC3=C2C=C4C(=C3)C5=C(C=C4)C=CC=C5)C=CC7=C6C=CC=C7 |
| InChI | 1S/C30H18/c1-3-7-25-19(5-1)9-11-21-17-29-23(15-27(21)25)13-14-24-16-28-22(18-30(24)29)12-10-20-6-2-4-8-26(20)28/h1-18H |
| InChIKey | RQCIQCDYYKLUBE-UHFFFAOYSA-N |
| Density | 1.287g/cm3 (Cal.) |
|---|---|
| Boiling point | 677.037°C at 760 mmHg (Cal.) |
| Flash point | 360.608°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibenzo(c,m)Pentaphene |