Online Database of Chemicals from Around the World
|
CAS#: 22203-98-1 Product: 5-Chloro-N-(3-Chlorophenyl)-2-Hydroxy-Benzamide No suppilers available for the product. |
| Name | 5-Chloro-N-(3-Chlorophenyl)-2-Hydroxy-Benzamide |
|---|---|
| Synonyms | 5-Chloro-N-(3-Chlorophenyl)-2-Hydroxy-Benzamide; Benzamide, 5-Chloro-N-(3-Chlorophenyl)-2-Hydroxy-; Nsc50643 |
| Molecular Structure |  |
| Molecular Formula | C13H9Cl2NO2 |
| Molecular Weight | 282.13 |
| CAS Registry Number | 22203-98-1 |
| SMILES | C1=CC(=CC(=C1O)C(=O)NC2=CC(=CC=C2)Cl)Cl |
| InChI | 1S/C13H9Cl2NO2/c14-8-2-1-3-10(6-8)16-13(18)11-7-9(15)4-5-12(11)17/h1-7,17H,(H,16,18) |
| InChIKey | NXDGLRGDIKDWIF-UHFFFAOYSA-N |
| Density | 1.48g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.491°C at 760 mmHg (Cal.) |
| Flash point | 172.424°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-N-(3-Chlorophenyl)-2-Hydroxy-Benzamide |