|
CAS#: 22225-67-8 Product: Macrosporin No suppilers available for the product. |
| Name | Macrosporin |
|---|---|
| Synonyms | 1,7-Dihydroxy-3-Methoxy-6-Methyl-Anthracene-9,10-Dione; 1,7-Dihydroxy-3-Methoxy-6-Methyl-9,10-Anthraquinone; 1,7-Dihydroxy-3-Methoxy-6-Methyl-9,10-Anthracenedione |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 |
| CAS Registry Number | 22225-67-8 |
| SMILES | C1=C(C(=CC3=C1C(C2=C(C=C(OC)C=C2C3=O)O)=O)C)O |
| InChI | 1S/C16H12O5/c1-7-3-9-10(6-12(7)17)16(20)14-11(15(9)19)4-8(21-2)5-13(14)18/h3-6,17-18H,1-2H3 |
| InChIKey | FKTPLNFTYJEAAB-UHFFFAOYSA-N |
| Density | 1.449g/cm3 (Cal.) |
|---|---|
| Boiling point | 546.88°C at 760 mmHg (Cal.) |
| Flash point | 209.848°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Macrosporin |