|
CAS#: 22277-04-9 Product: 7-Nitro-2,4,9-Triazabicyclo[4.3.0]Nona-3,7,10-Triene-5-Thione No suppilers available for the product. |
| Name | 7-Nitro-2,4,9-Triazabicyclo[4.3.0]Nona-3,7,10-Triene-5-Thione |
|---|---|
| Synonyms | Nsc107513 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H4N4O2S |
| Molecular Weight | 196.18 |
| CAS Registry Number | 22277-04-9 |
| SMILES | C1=C([N+]([O-])=O)C2=C([NH]1)NC=NC2=S |
| InChI | 1S/C6H4N4O2S/c11-10(12)3-1-7-5-4(3)6(13)9-2-8-5/h1-2H,(H2,7,8,9,13) |
| InChIKey | ZMAIWNXBVJHOHB-UHFFFAOYSA-N |
| Density | 1.956g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.736°C at 760 mmHg (Cal.) |
| Flash point | 249.983°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Nitro-2,4,9-Triazabicyclo[4.3.0]Nona-3,7,10-Triene-5-Thione |