|
CAS#: 22289-05-0 Product: 3-Methylene-2,6-Heptanedione No suppilers available for the product. |
| Name | 3-Methylene-2,6-Heptanedione |
|---|---|
| Synonyms | 3-Methyleneheptane-2,6-dione; 3-Methylene-heptane-2,6-dione; InChI=1/C8H12O2/c1-6(8(3)10)4-5-7(2)9/h1,4-5H2,2-3H3 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 |
| CAS Registry Number | 22289-05-0 |
| SMILES | CC(=O)CCC(=C)C(=O)C |
| InChI | 1S/C8H12O2/c1-6(8(3)10)4-5-7(2)9/h1,4-5H2,2-3H3 |
| InChIKey | FFPAMXZGKPTNDP-UHFFFAOYSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 246.5±23.0°C at 760 mmHg (Cal.) |
| Flash point | 90.5±19.6°C (Cal.) |
| Refractive index | 1.431 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Perry T Kaye and Xolani W. Nocanda. A convenient general synthesis of 3-substituted 2H-chromene derivatives, J. Chem. Soc., Perkin Trans. 1, 2002, 0, 1318. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Methylene-2,6-Heptanedione |