|
CAS#: 22296-44-2 Product: 2,7-Dichloro-9H-Fluoren-9-One Oxime No suppilers available for the product. |
| Name | 2,7-Dichloro-9H-Fluoren-9-One Oxime |
|---|---|
| Synonyms | 2,7-Dichlorofluoren-9-One Oxime; 2,7-Dichloro-9-Fluorenone Oxime; 1-07-00-00253 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C13H7Cl2NO |
| Molecular Weight | 264.11 |
| CAS Registry Number | 22296-44-2 |
| SMILES | C1=CC(=CC2=C1C3=C(C2=NO)C=C(C=C3)Cl)Cl |
| InChI | 1S/C13H7Cl2NO/c14-7-1-3-9-10-4-2-8(15)6-12(10)13(16-17)11(9)5-7/h1-6,17H |
| InChIKey | QBEGYWPUWWKWOB-UHFFFAOYSA-N |
| Density | 1.492g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.616°C at 760 mmHg (Cal.) |
| Flash point | 235.396°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,7-Dichloro-9H-Fluoren-9-One Oxime |