|
CAS#: 22336-84-1 Product: Metergotamine No suppilers available for the product. |
| Name | Metergotamine |
|---|---|
| Synonyms | 1-Methylergotamine; Metergotamina [Inn-Spanish]; Metergotamina [Spanish] |
| Molecular Structure | ![]() |
| Molecular Formula | C34H37N5O5 |
| Molecular Weight | 595.70 |
| CAS Registry Number | 22336-84-1 |
| SMILES | [C@]18(N([C@H](C(=O)N2[C@H]1CCC2)CC3=CC=CC=C3)C([C@@](NC([C@@H]7C=C6C4=CC=CC5=C4C(=C[N]5C)C[C@H]6N(C7)C)=O)(C)O8)=O)O |
| InChI | 1S/C34H37N5O5/c1-33(32(42)39-27(15-20-9-5-4-6-10-20)31(41)38-14-8-13-28(38)34(39,43)44-33)35-30(40)22-16-24-23-11-7-12-25-29(23)21(18-36(25)2)17-26(24)37(3)19-22/h4-7,9-12,16,18,22,26-28,43H,8,13-15,17,19H2,1-3H3,(H,35,40)/t22-,26-,27+,28+,33-,34+/m1/s1 |
| InChIKey | SZUQJDJBJHBVBO-CTTKVJGISA-N |
| Density | 1.481g/cm3 (Cal.) |
|---|---|
| Boiling point | 909.129°C at 760 mmHg (Cal.) |
| Flash point | 503.623°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Metergotamine |