|
CAS#: 22394-31-6 Product: N-Phenyl-1H-Indole-3-Methanimine No suppilers available for the product. |
| Name | N-Phenyl-1H-Indole-3-Methanimine |
|---|---|
| Synonyms | N-[(Z)-Indol-3-Ylidenemethyl]Aniline; N-(3-Indolylidenemethyl)Aniline; N-[(Z)-3-Indolylidenemethyl]Aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12N2 |
| Molecular Weight | 220.27 |
| CAS Registry Number | 22394-31-6 |
| SMILES | C3=C2\C(=C\NC1=CC=CC=C1)C=NC2=CC=C3 |
| InChI | 1S/C15H12N2/c1-2-6-13(7-3-1)16-10-12-11-17-15-9-5-4-8-14(12)15/h1-11,16H/b12-10+ |
| InChIKey | ZLKHCIDLVLXDFY-ZRDIBKRKSA-N |
| Density | 1.113g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.09°C at 760 mmHg (Cal.) |
| Flash point | 193.953°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Phenyl-1H-Indole-3-Methanimine |