|
CAS#: 22396-00-5 Product: 3-(4-Nitrophenyl)-2-Propyloxaziridine No suppilers available for the product. |
| Name | 3-(4-Nitrophenyl)-2-Propyloxaziridine |
|---|---|
| Synonyms | 3-(4-Nitrophenyl)-2-propyl-1,2-oxaziridine # |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.21 |
| CAS Registry Number | 22396-00-5 |
| SMILES | [O-][N+](=O)c1ccc(cc1)C2ON2CCC |
| InChI | 1S/C10H12N2O3/c1-2-7-11-10(15-11)8-3-5-9(6-4-8)12(13)14/h3-6,10H,2,7H2,1H3 |
| InChIKey | DJPUCMDZQWMPOK-UHFFFAOYSA-N |
| Density | 1.258g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.827°C at 760 mmHg (Cal.) |
| Flash point | 139.364°C (Cal.) |
| Refractive index | 1.576 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Nitrophenyl)-2-Propyloxaziridine |