|
CAS#: 22404-53-1 Product: 3-[N-(2-Pyridyl)Formimidoyl]-1H-Indole No suppilers available for the product. |
| Name | 3-[N-(2-Pyridyl)Formimidoyl]-1H-Indole |
|---|---|
| Synonyms | N-[(Z)-3-Indolylidenemethyl]-2-Pyridinamine; [(Z)-Indol-3-Ylidenemethyl]-(2-Pyridyl)Amine; Indole, 3-(N-2-Pyridylformimidoyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11N3 |
| Molecular Weight | 221.26 |
| CAS Registry Number | 22404-53-1 |
| SMILES | C2=C1\C(C=NC1=CC=C2)=C\NC3=CC=CC=N3 |
| InChI | 1S/C14H11N3/c1-2-6-13-12(5-1)11(9-16-13)10-17-14-7-3-4-8-15-14/h1-10H,(H,15,17)/b11-10+ |
| InChIKey | NTAWERCRVCATPT-ZHACJKMWSA-N |
| Density | 1.186g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.017°C at 760 mmHg (Cal.) |
| Flash point | 209.633°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[N-(2-Pyridyl)Formimidoyl]-1H-Indole |