|
CAS#: 22442-56-4 Product: 2-(4-Amino-3,5-Dimethylphenyl)-1,1,2-Ethenetricarbonitrile No suppilers available for the product. |
| Name | 2-(4-Amino-3,5-Dimethylphenyl)-1,1,2-Ethenetricarbonitrile |
|---|---|
| Synonyms | 2-(4-Amin |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10N4 |
| Molecular Weight | 222.25 |
| CAS Registry Number | 22442-56-4 |
| SMILES | N#C/C(C#N)=C(/C#N)c1cc(c(N)c(c1)C)C |
| InChI | 1S/C13H10N4/c1-8-3-10(4-9(2)13(8)17)12(7-16)11(5-14)6-15/h3-4H,17H2,1-2H3 |
| InChIKey | QGVWLOSATKTYAA-UHFFFAOYSA-N |
| Density | 1.224g/cm3 (Cal.) |
|---|---|
| Boiling point | 395.923°C at 760 mmHg (Cal.) |
| Flash point | 193.248°C (Cal.) |
| Refractive index | 1.617 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Amino-3,5-Dimethylphenyl)-1,1,2-Ethenetricarbonitrile |