|
CAS#: 22498-86-8 Product: 1,1'-(2,7-Dimethyl-2,6-Octadien-4-Yne-3,6-Diyl)Dibenzene No suppilers available for the product. |
| Name | 1,1'-(2,7-Dimethyl-2,6-Octadien-4-Yne-3,6-Diyl)Dibenzene |
|---|---|
| Synonyms | [5-Methyl |
| Molecular Structure | ![]() |
| Molecular Formula | C22H22 |
| Molecular Weight | 286.41 |
| CAS Registry Number | 22498-86-8 |
| SMILES | C(#C\C(=C(/C)C)c1ccccc1)/C(c2ccccc2)=C(/C)C |
| InChI | 1S/C22H22/c1-17(2)21(19-11-7-5-8-12-19)15-16-22(18(3)4)20-13-9-6-10-14-20/h5-14H,1-4H3 |
| InChIKey | CMNUOXZWGRAXKF-UHFFFAOYSA-N |
| Density | 0.995g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.876°C at 760 mmHg (Cal.) |
| Flash point | 200.947°C (Cal.) |
| Refractive index | 1.579 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-(2,7-Dimethyl-2,6-Octadien-4-Yne-3,6-Diyl)Dibenzene |