Online Database of Chemicals from Around the World
|
CAS#: 225-57-0 Product: 6H-Thiochromeno[4,3-b]Quinoline No suppilers available for the product. |
| Name | 6H-Thiochromeno[4,3-b]Quinoline |
|---|---|
| Synonyms | 4-27-00-01473 (Beilstein Handbook Reference); 6H-(1)Benzothiopyrano(4,3-B)Quinoline; Brn 0187735 |
| Molecular Structure | ![CAS#: 225-57-0, 6H-Thiochromeno[4,3-b]Quinoline](/moreStructures/225-57-0.gif) |
| Molecular Formula | C16H11NS |
| Molecular Weight | 249.33 |
| CAS Registry Number | 225-57-0 |
| SMILES | C1=CC=CC4=C1C2=C(C=C3C(=N2)C=CC=C3)CS4 |
| InChI | 1S/C16H11NS/c1-3-7-14-11(5-1)9-12-10-18-15-8-4-2-6-13(15)16(12)17-14/h1-9H,10H2 |
| InChIKey | PNSMXZODIXFDRD-UHFFFAOYSA-N |
| Density | 1.293g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.142°C at 760 mmHg (Cal.) |
| Flash point | 242.367°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6H-Thiochromeno[4,3-b]Quinoline |