|
CAS#: 22535-53-1 Product: N-(4-Acetylphenyl)Prop-2-Enamide No suppilers available for the product. |
| Name | N-(4-Acetylphenyl)Prop-2-Enamide |
|---|---|
| Synonyms | N-(4-Acetylphenyl)Acrylamide; N-(4-Ethanoylphenyl)Prop-2-Enamide; 4'-Acetylacrylanilide |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 |
| CAS Registry Number | 22535-53-1 |
| EINECS | 245-063-7 |
| SMILES | C1=C(C(=O)C)C=CC(=C1)NC(C=C)=O |
| InChI | 1S/C11H11NO2/c1-3-11(14)12-10-6-4-9(5-7-10)8(2)13/h3-7H,1H2,2H3,(H,12,14) |
| InChIKey | DZFGSPKLORYTIN-UHFFFAOYSA-N |
| Density | 1.142g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.667°C at 760 mmHg (Cal.) |
| Flash point | 173.187°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Acetylphenyl)Prop-2-Enamide |