|
CAS#: 22550-76-1 Product: (3beta,6alpha,16beta,21beta)-Hopane-3,6,16,22-Tetrol No suppilers available for the product. |
| Name | (3beta,6alpha,16beta,21beta)-Hopane-3,6,16,22-Tetrol |
|---|---|
| Synonyms | A'-Neogammacerane-3,6,16,22-tetrol, (3β,6α,16β,21β)-; mollugogenol A |
| Molecular Structure | ![]() |
| Molecular Formula | C30H52O4 |
| Molecular Weight | 476.73 |
| CAS Registry Number | 22550-76-1 |
| SMILES | OC(C)(C)[C@H]5[C@H]4[C@]([C@@H]3[C@@]([C@]1([C@@H]([C@]2(C)[C@@H]([C@@H](O)C1)C(C)(C)[C@@H](O)CC2)CC3)C)(C)C[C@@H]4O)(C)CC5 |
| InChI | 1S/C30H52O4/c1-25(2)22(33)12-14-28(6)21-10-9-20-27(5)13-11-17(26(3,4)34)23(27)18(31)15-29(20,7)30(21,8)16-19(32)24(25)28/h17-24,31-34H,9-16H2,1-8H3/t17-,18+,19+,20-,21-,22+,23-,24+,27-,28-,29-,30-/m1/s1 |
| InChIKey | USLXSBTYECTZSS-HAYDXIIZSA-N |
| Density | 1.103g/cm3 (Cal.) |
|---|---|
| Boiling point | 576.31°C at 760 mmHg (Cal.) |
| Flash point | 234.815°C (Cal.) |
| Refractive index | 1.545 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3beta,6alpha,16beta,21beta)-Hopane-3,6,16,22-Tetrol |