| Creative Peptides | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 624-4882 | |||
![]() |
info@creative-peptides.com | |||
| Chemical manufacturer | ||||
| chemBlink massive supplier since 2016 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | Glycyl-L-Tyrosyl-L-Prolylglycyl-L-Glutaminyl-L-Valine |
|---|---|
| Synonyms | PAR 4 (1-6) |
| Molecular Structure | ![]() |
| Molecular Formula | C28H40N7O9 |
| Molecular Weight | 619.67 |
| CAS Registry Number | 225779-44-2 |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)[C@H](CCC(=O)N)NC(=O)CNC(=O)[C@@H]1CCCN1C(=O)[C@H](CC2=CC=C(C=C2)O)NC(=O)CN |
| InChI | 1S/C28H41N7O9/c1-15(2)24(28(43)44)34-25(40)18(9-10-21(30)37)32-23(39)14-31-26(41)20-4-3-11-35(20)27(42)19(33-22(38)13-29)12-16-5-7-17(36)8-6-16/h5-8,15,18-20,24,36H,3-4,9-14,29H2,1-2H3,(H2,30,37)(H,31,41)(H,32,39)(H,33,38)(H,34,40)(H,43,44)/t18-,19-,20-,24-/m0/s1 |
| InChIKey | VTCFYKYDKDAJKZ-XHOYROJHSA-N |
| Protein Sequence | H-Ala-Tyr-Pro-Gly-Lys-Phe-NH2 |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 1164.4±65.0°C at 760 mmHg (Cal.) |
| Flash point | 658.0±34.3°C (Cal.) |
| Refractive index | 1.588 (Cal.) |
| solubility | Soluble to 3 mg/ml in 20% acetonitrile / water |
| Market Analysis Reports |
| List of Reports Available for Glycyl-L-Tyrosyl-L-Prolylglycyl-L-Glutaminyl-L-Valine |